Products 1912404-14-8
CAS 1912404-14-8 is the registry number for Nrf2 activator-21. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-7-methoxychromen-2-one (CAS 1912404-14-8) is a chemical compound with the molecular formula C19H14O5 and a molecular weight of 322.3 g/mol. IUPAC name: 3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-7-methoxychromen-2-one. InChIKey: SWZWRUPKBHYYGO-RUDMXATFSA-N.
| Molecular formula | C19H14O5 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-7-methoxychromen-2-one |
| InChIKey | SWZWRUPKBHYYGO-RUDMXATFSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)/C=C/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Nrf2 activator-21