CAS 1914971-97-3 is the registry number for Tyrosinase-IN-42. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-[(2-acetyl-5-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5-hydroxypyran-4-one (CAS 1914971-97-3) is a chemical compound with the molecular formula C18H17N3O6 and a molecular weight of 371.3 g/mol. IUPAC name: 2-[[4-[(2-acetyl-5-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5-hydroxypyran-4-one. InChIKey: OXOGOHHUPQWZIM-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O6 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 2-[[4-[(2-acetyl-5-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5-hydroxypyran-4-one |
| InChIKey | OXOGOHHUPQWZIM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OCC2=CN(N=N2)CC3=CC(=O)C(=CO3)O |
Computed by PubChem (NCBI)