CAS 1914989-49-3 appears in our catalog under these names: BPN-15606, 98%, BPN–15606, BPN-15606, BPN-15606, 99.96%, 99.96%, BPN-15606, 99.96%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 25 mg.
N-[(1S)-1-(4-fluorophenyl)ethyl]-6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-4-methylpyridazin-3-amine (CAS 1914989-49-3) is a chemical compound with the molecular formula C23H23FN6O and a molecular weight of 418.5 g/mol. IUPAC name: N-[(1S)-1-(4-fluorophenyl)ethyl]-6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-4-methylpyridazin-3-amine. InChIKey: JZCREVMHGYOLRL-INIZCTEOSA-N.
| Molecular formula | C23H23FN6O |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | N-[(1S)-1-(4-fluorophenyl)ethyl]-6-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-4-methylpyridazin-3-amine |
| InChIKey | JZCREVMHGYOLRL-INIZCTEOSA-N |
| SMILES | CC1=CC(=NN=C1N[C@@H](C)C2=CC=C(C=C2)F)C3=NC(=C(C=C3)N4C=C(N=C4)C)OC |
Computed by PubChem (NCBI)