CAS 191544-97-5 appears in our catalog under these names: 5–iodo–1–trityl–1H–imidazole, 5-Iodo-1-trityl-1h-imidazole, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-iodo-1-tritylimidazole (CAS 191544-97-5) is a chemical compound with the molecular formula C22H17IN2 and a molecular weight of 436.3 g/mol. IUPAC name: 5-iodo-1-tritylimidazole. InChIKey: RHIHYGRNJPIXIV-UHFFFAOYSA-N.
| Molecular formula | C22H17IN2 |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | 5-iodo-1-tritylimidazole |
| InChIKey | RHIHYGRNJPIXIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=NC=C4I |
Computed by PubChem (NCBI)