CAS 191611-89-9 appears in our catalog under these names: SIB-1553A, 98%, SIB 1553A Hyrdrochloride, SIB-1553A hydrochloride/ 99.71% (existing batch purity), SIB 1553A hydrochloride, SIB-1553A. Offered by: AmBeed, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 100mg, 10mg, 50mg, 5mg, 25mg, 2mg, 200mg.
4-[2-(1-methylpyrrolidin-2-yl)ethylsulfanyl]phenol;hydrochloride (CAS 191611-89-9) is a chemical compound with the molecular formula C13H20ClNOS and a molecular weight of 273.82 g/mol. IUPAC name: 4-[2-(1-methylpyrrolidin-2-yl)ethylsulfanyl]phenol;hydrochloride. InChIKey: RJSVKPQKXSMZMT-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNOS |
|---|---|
| Molecular weight | 273.82 g/mol |
| IUPAC name | 4-[2-(1-methylpyrrolidin-2-yl)ethylsulfanyl]phenol;hydrochloride |
| InChIKey | RJSVKPQKXSMZMT-UHFFFAOYSA-N |
| SMILES | CN1CCCC1CCSC2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)