CAS 1916490-96-4 is the registry number for N-((2,4-Difluorophenyl)methylene)-2,4-difluoro-benzenemethanamine. Offered by: TRC. Available pack sizes: 100mg.
1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanimine (CAS 1916490-96-4) is a chemical compound with the molecular formula C14H9F4N and a molecular weight of 267.22 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanimine. InChIKey: PGPHQWXWIJMODM-UHFFFAOYSA-N.
| Molecular formula | C14H9F4N |
|---|---|
| Molecular weight | 267.22 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-N-[(2,4-difluorophenyl)methyl]methanimine |
| InChIKey | PGPHQWXWIJMODM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CN=CC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)