CAS 1916504-21-6 is the registry number for (S)-Dibenzo[b,d]furan-4-yl(dibenzo[b,d]thiophen-4-yl)(phenyl)phosphine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibenzofuran-4-yl-dibenzothiophen-4-yl-phenylphosphane (CAS 1916504-21-6) is a chemical compound with the molecular formula C30H19OPS and a molecular weight of 458.5 g/mol. IUPAC name: dibenzofuran-4-yl-dibenzothiophen-4-yl-phenylphosphane. InChIKey: QKJAGPAKUISYLE-YTTGMZPUSA-N.
| Molecular formula | C30H19OPS |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | dibenzofuran-4-yl-dibenzothiophen-4-yl-phenylphosphane |
| InChIKey | QKJAGPAKUISYLE-YTTGMZPUSA-N |
| SMILES | C1=CC=C(C=C1)[P@@](C2=CC=CC3=C2OC4=CC=CC=C34)C5=CC=CC6=C5SC7=CC=CC=C67 |
Computed by PubChem (NCBI)