CAS 19169-90-5 appears in our catalog under these names: Bromomethyl phenyl sulfone, 98%, Bromomethylphenylsulfone, 95%, 95%, ((Bromomethyl)sulfonyl)benzene, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
Bromomethylsulfonylbenzene (CAS 19169-90-5) is a chemical compound with the molecular formula C7H7BrO2S and a molecular weight of 235.10 g/mol. IUPAC name: bromomethylsulfonylbenzene. InChIKey: SKIMEKUYIQHJQV-UHFFFAOYSA-N.
| Molecular formula | C7H7BrO2S |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | bromomethylsulfonylbenzene |
| InChIKey | SKIMEKUYIQHJQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CBr |
Computed by PubChem (NCBI)