CAS 191723-53-2 is the registry number for L-Isoleucine 7-amido-4-methylcoumarin trifluroacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide;2,2,2-trifluoroacetic acid (CAS 191723-53-2) is a chemical compound with the molecular formula C18H21F3N2O5 and a molecular weight of 402.4 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide;2,2,2-trifluoroacetic acid. InChIKey: XPPJTDCCTDQORL-UXZWUECBSA-N.
| Molecular formula | C18H21F3N2O5 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide;2,2,2-trifluoroacetic acid |
| InChIKey | XPPJTDCCTDQORL-UXZWUECBSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)