CAS 1917295-47-6 is the registry number for 5-(4-((3,5-Dicarboxyphenyl)ethynyl)naphthalen-1-yl)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]ethynyl]benzene-1,3-dicarboxylic acid (CAS 1917295-47-6) is a chemical compound with the molecular formula C28H16O8 and a molecular weight of 480.4 g/mol. IUPAC name: 5-[2-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]ethynyl]benzene-1,3-dicarboxylic acid. InChIKey: PPNMHCGDGSJHEH-UHFFFAOYSA-N.
| Molecular formula | C28H16O8 |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 5-[2-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]ethynyl]benzene-1,3-dicarboxylic acid |
| InChIKey | PPNMHCGDGSJHEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC(=CC(=C3)C(=O)O)C(=O)O)C#CC4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)