Products 1917352-28-3

CAS 1917352-28-3 is the registry number for 1-((2-(Trimethylsilyl)ethoxy)methyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid (CAS 1917352-28-3) is a chemical compound with the molecular formula C10H18N2O3Si and a molecular weight of 242.35 g/mol. IUPAC name: 1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid. InChIKey: JMANBDUPQGWBCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O3Si
Molecular weight242.35 g/mol
IUPAC name1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid
InChIKeyJMANBDUPQGWBCJ-UHFFFAOYSA-N
SMILESC[Si](C)(C)CCOCN1C=C(C=N1)C(=O)O

Computed by PubChem (NCBI)