CAS 19178-80-4 is the registry number for 1-(4-((4-Chlorophenyl)phenylmethyl)-1-piperazinyl)ethanone Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanone;hydrochloride (CAS 19178-80-4) is a chemical compound with the molecular formula C19H22Cl2N2O and a molecular weight of 365.3 g/mol. IUPAC name: 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanone;hydrochloride. InChIKey: RXDBAXJUDXCBSD-UHFFFAOYSA-N.
| Molecular formula | C19H22Cl2N2O |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanone;hydrochloride |
| InChIKey | RXDBAXJUDXCBSD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)