CAS 19182-14-0 is the registry number for (6-Methylnaphthalen-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2g, 5g.
(6-methylnaphthalen-2-yl)methanol (CAS 19182-14-0) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: (6-methylnaphthalen-2-yl)methanol. InChIKey: QMVKKYLKTADYNN-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (6-methylnaphthalen-2-yl)methanol |
| InChIKey | QMVKKYLKTADYNN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)CO |
Computed by PubChem (NCBI)