CAS 19182-81-1 appears in our catalog under these names: 1,4–Dinitroimidazole, 1,4-Dinitro-1H-imidazole, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
1,4-dinitroimidazole (CAS 19182-81-1) is a chemical compound with the molecular formula C3H2N4O4 and a molecular weight of 158.07 g/mol. IUPAC name: 1,4-dinitroimidazole. InChIKey: HZPSREFSUPXCMN-UHFFFAOYSA-N.
| Molecular formula | C3H2N4O4 |
|---|---|
| Molecular weight | 158.07 g/mol |
| IUPAC name | 1,4-dinitroimidazole |
| InChIKey | HZPSREFSUPXCMN-UHFFFAOYSA-N |
| SMILES | C1=C(N=CN1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)