Products 1918951-37-7
CAS 1918951-37-7 is the registry number for tert-Butyl 6,6-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6,6-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CAS 1918951-37-7) is a chemical compound with the molecular formula C14H23N3O4 and a molecular weight of 297.35 g/mol. IUPAC name: tert-butyl 6,6-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate. InChIKey: QNLMEADGMGTUHP-UHFFFAOYSA-N.
| Molecular formula | C14H23N3O4 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | tert-butyl 6,6-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| InChIKey | QNLMEADGMGTUHP-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCC12C(=O)NC(=O)N2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)