Products 1919009-12-3

CAS 1919009-12-3 is the registry number for 3-([3,2':6',3''-Terpyridin]-4'-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid (CAS 1919009-12-3) is a chemical compound with the molecular formula C22H15N3O2 and a molecular weight of 353.4 g/mol. IUPAC name: 3-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid. InChIKey: OEIUFPDFHURLDK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H15N3O2
Molecular weight353.4 g/mol
IUPAC name3-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid
InChIKeyOEIUFPDFHURLDK-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CC(=NC(=C2)C3=CN=CC=C3)C4=CN=CC=C4

Computed by PubChem (NCBI)