CAS 2229897-55-4 is the registry number for 2-([3,2':6',3''-Terpyridin]-4'-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid (CAS 2229897-55-4) is a chemical compound with the molecular formula C22H15N3O2 and a molecular weight of 353.4 g/mol. IUPAC name: 2-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid. InChIKey: PQJBWLLADIZXCU-UHFFFAOYSA-N.
| Molecular formula | C22H15N3O2 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 2-(2,6-dipyridin-3-yl-4-pyridinyl)benzoic acid |
| InChIKey | PQJBWLLADIZXCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NC(=C2)C3=CN=CC=C3)C4=CN=CC=C4)C(=O)O |
Computed by PubChem (NCBI)