CAS 1919043-11-0 appears in our catalog under these names: H-L-Tyr(Propargyl)-OH*HCl, (S)-2-amino-3-(4-(prop-2-yn-1-yloxy)phenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg, 100mg.
(2S)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid;hydrochloride (CAS 1919043-11-0) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: (2S)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid;hydrochloride. InChIKey: RZCRZLTYSXRCIH-MERQFXBCSA-N.
| Molecular formula | C12H14ClNO3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | RZCRZLTYSXRCIH-MERQFXBCSA-N |
| SMILES | C#CCOC1=CC=C(C=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)