CAS 19192-78-0 is the registry number for Selenomethionine Selenoxide. Offered by: TRC. Available pack sizes: 50mg.
(2S)-2-amino-4-methylseleninylbutanoic acid (CAS 19192-78-0) is a chemical compound with the molecular formula C5H11NO3Se and a molecular weight of 212.12 g/mol. IUPAC name: (2S)-2-amino-4-methylseleninylbutanoic acid. InChIKey: KGXZPWNBFWCDRF-YGVKFDHGSA-N.
| Molecular formula | C5H11NO3Se |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | (2S)-2-amino-4-methylseleninylbutanoic acid |
| InChIKey | KGXZPWNBFWCDRF-YGVKFDHGSA-N |
| SMILES | C[Se](=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)