CAS 191931-56-3 appears in our catalog under these names: NTNCB Hydrochloride, NTNCB HCl, 98%, NTNCB hydrochloride/ 97.92% (existing batch purity), NTNCB hydrochloride, NTNCB HCl 98%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg, 100mg, 250mg, 25 mg.
2-nitro-N-[[4-[(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide;hydrochloride (CAS 191931-56-3) is a chemical compound with the molecular formula C25H34ClN3O4S and a molecular weight of 508.1 g/mol. IUPAC name: 2-nitro-N-[[4-[(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide;hydrochloride. InChIKey: BKCQHNDMUNWNQC-UHFFFAOYSA-N.
| Molecular formula | C25H34ClN3O4S |
|---|---|
| Molecular weight | 508.1 g/mol |
| IUPAC name | 2-nitro-N-[[4-[(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)methyl]cyclohexyl]methyl]benzenesulfonamide;hydrochloride |
| InChIKey | BKCQHNDMUNWNQC-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CNCC2CCC3=CC=CC=C3C2)CNS(=O)(=O)C4=CC=CC=C4[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)