CAS 191983-33-2 appears in our catalog under these names: 2-Bromo-4-(1,1-dimethylethyl)-6-iodobenzenamine, 97%, 2-Bromo-4-(tert-butyl)-6-iodoaniline, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g.
2-bromo-4-tert-butyl-6-iodoaniline (CAS 191983-33-2) is a chemical compound with the molecular formula C10H13BrIN and a molecular weight of 354.02 g/mol. IUPAC name: 2-bromo-4-tert-butyl-6-iodoaniline. InChIKey: VMBRFLUFONEMTA-UHFFFAOYSA-N.
| Molecular formula | C10H13BrIN |
|---|---|
| Molecular weight | 354.02 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-6-iodoaniline |
| InChIKey | VMBRFLUFONEMTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)I)N)Br |
Computed by PubChem (NCBI)