CAS 1919868-77-1 appears in our catalog under these names: (R)-2-(2,5-Difluorophenyl)pyrrolidine (R)-2-hydroxysuccinate, 97%, 2-(2,5-Difluorophenyl)pyrrolidine (R)-2-hydroxysuccinate, 95%, 95%, 2-(2,5-Difluorophenyl)pyrrolidine (R)-2-hydroxysuccinate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
(2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid (CAS 1919868-77-1) is a chemical compound with the molecular formula C14H17F2NO5 and a molecular weight of 317.28 g/mol. IUPAC name: (2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid. InChIKey: KMLXGOHWKMHXAE-SBHYBIRFSA-N.
| Molecular formula | C14H17F2NO5 |
|---|---|
| Molecular weight | 317.28 g/mol |
| IUPAC name | (2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid |
| InChIKey | KMLXGOHWKMHXAE-SBHYBIRFSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)F)F.C([C@H](C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)