CAS 1919877-33-0 is the registry number for 4-Aminobenzonitrile-13C6. Offered by: TRC. Available pack sizes: 100mg.
4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile (CAS 1919877-33-0) is a chemical compound with the molecular formula C7H6N2 and a molecular weight of 124.092 g/mol. IUPAC name: 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile. InChIKey: YBAZINRZQSAIAY-ZFJHNFROSA-N.
| Molecular formula | C7H6N2 |
|---|---|
| Molecular weight | 124.092 g/mol |
| IUPAC name | 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile |
| InChIKey | YBAZINRZQSAIAY-ZFJHNFROSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1C#N)N |
Computed by PubChem (NCBI)