Products 1919892-58-2
CAS 1919892-58-2 is the registry number for (4-chlorophenyl)(ethyl)(imino)-λ6-sulfanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
(4-chlorophenyl)-ethyl-imino-oxo-lambda6-sulfane (CAS 1919892-58-2) is a chemical compound with the molecular formula C8H10ClNOS and a molecular weight of 203.69 g/mol. IUPAC name: (4-chlorophenyl)-ethyl-imino-oxo-lambda6-sulfane. InChIKey: NDAXDFFYZPAKON-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNOS |
|---|---|
| Molecular weight | 203.69 g/mol |
| IUPAC name | (4-chlorophenyl)-ethyl-imino-oxo-lambda6-sulfane |
| InChIKey | NDAXDFFYZPAKON-UHFFFAOYSA-N |
| SMILES | CCS(=N)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)