Products 19202-59-6
CAS 19202-59-6 is the registry number for 3,6-Dichloroacenaphthene. Offered by: TRC. Available pack sizes: 0,5mg, 2,5mg, 5mg.
3,6-dichloro-1,2-dihydroacenaphthylene (CAS 19202-59-6) is a chemical compound with the molecular formula C12H8Cl2 and a molecular weight of 223.09 g/mol. IUPAC name: 3,6-dichloro-1,2-dihydroacenaphthylene. InChIKey: TVHGPTICOAVVGB-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2 |
|---|---|
| Molecular weight | 223.09 g/mol |
| IUPAC name | 3,6-dichloro-1,2-dihydroacenaphthylene |
| InChIKey | TVHGPTICOAVVGB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C(C=CC1=C23)Cl)Cl |
Computed by PubChem (NCBI)