CAS 192185-72-1 appears in our catalog under these names: Tipifarnib, >95% (HPLC), Tipifarnib/ 99.22% (existing batch purity), Tipifarnib (Zarnestra), Tipifarnib, Tipifarnib, >95.0%(HPLC). Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 25mg, 5mg, 1mg, 2mg, 10mg, 50mg, 10mM (in 1ml dmso), 100mg.
6-[(R)-amino-(4-chlorophenyl)-(3-methylimidazol-4-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one (CAS 192185-72-1) is a chemical compound with the molecular formula C27H22Cl2N4O and a molecular weight of 489.4 g/mol. IUPAC name: 6-[(R)-amino-(4-chlorophenyl)-(3-methylimidazol-4-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one. InChIKey: PLHJCIYEEKOWNM-HHHXNRCGSA-N.
| Molecular formula | C27H22Cl2N4O |
|---|---|
| Molecular weight | 489.4 g/mol |
| IUPAC name | 6-[(R)-amino-(4-chlorophenyl)-(3-methylimidazol-4-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one |
| InChIKey | PLHJCIYEEKOWNM-HHHXNRCGSA-N |
| SMILES | CN1C=NC=C1[C@@](C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N |
Computed by PubChem (NCBI)