Products 19223-69-9

CAS 19223-69-9 is the registry number for (3-Aminopropyl)trimethylazanium chloride. Offered by: Biosynth. Available pack sizes: 0,005g, 0,01g, 0,025g, 0,05g, 0,1g.

Structural formula: {0} (CAS {1})

3-aminopropyl(trimethyl)azanium chloride (CAS 19223-69-9) is a chemical compound with the molecular formula C6H17ClN2 and a molecular weight of 152.66 g/mol. IUPAC name: 3-aminopropyl(trimethyl)azanium chloride. InChIKey: SLCCHLCXVOABIB-UHFFFAOYSA-M.

Identity
Molecular formulaC6H17ClN2
Molecular weight152.66 g/mol
IUPAC name3-aminopropyl(trimethyl)azanium chloride
InChIKeySLCCHLCXVOABIB-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCCN.[Cl-]

Computed by PubChem (NCBI)