CAS 19230-57-0 appears in our catalog under these names: 2-Bromo-3-methylpyridine 1-oxide, 95%, 2–Bromo–3–Methylpyridine 1–Oxide, 2-Bromo-3-methylpyridine 1-oxide, 97%, 97%, 2-Bromo-3-methylpyridine 1-oxide, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-bromo-3-methyl-1-oxidopyridin-1-ium (CAS 19230-57-0) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 2-bromo-3-methyl-1-oxidopyridin-1-ium. InChIKey: RAQYFPHUNLDWFT-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 2-bromo-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | RAQYFPHUNLDWFT-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])Br |
Computed by PubChem (NCBI)