CAS 19230-58-1 appears in our catalog under these names: 2–Bromo–5–methylpyridine 1–oxide, 2-Bromo-5-methylpyridine 1-oxide, 95%, 2-Bromo-5-methylpyridine 1-oxide 98%, 2-Bromo-5-methylpyridine 1-oxide, 98%, 2-bromo-5-methylpyridine 1-oxide, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-bromo-5-methyl-1-oxidopyridin-1-ium (CAS 19230-58-1) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 2-bromo-5-methyl-1-oxidopyridin-1-ium. InChIKey: PJPYKXAQHIYIFY-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 2-bromo-5-methyl-1-oxidopyridin-1-ium |
| InChIKey | PJPYKXAQHIYIFY-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1)Br)[O-] |
Computed by PubChem (NCBI)