CAS 192315-36-9 appears in our catalog under these names: Boc–Tyr(3–Cl)–OH, Boc-Try(3-cl)-OH, 98%, 98%, (S)-2-((tert-butoxycarbonyl)amino)-3-(3-chloro-4-hydroxyphenyl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 100mg, 250mg, 1g.
(2S)-3-(3-chloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 192315-36-9) is a chemical compound with the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. IUPAC name: (2S)-3-(3-chloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZEMKCIHCRJIZOO-JTQLQIEISA-N.
| Molecular formula | C14H18ClNO5 |
|---|---|
| Molecular weight | 315.75 g/mol |
| IUPAC name | (2S)-3-(3-chloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZEMKCIHCRJIZOO-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)O)Cl)C(=O)O |
Computed by PubChem (NCBI)