Products 192323-14-1

CAS 192323-14-1 is the registry number for hACC2-IN-1, 99.86%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 10mM/1mL, 25 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[[4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexyl]methyl]carbamate (CAS 192323-14-1) is a chemical compound with the molecular formula C23H32N2O4S and a molecular weight of 432.6 g/mol. IUPAC name: tert-butyl N-[[4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexyl]methyl]carbamate. InChIKey: NCTLNAWWXKBSSW-UHFFFAOYSA-N.

Identity
Molecular formulaC23H32N2O4S
Molecular weight432.6 g/mol
IUPAC nametert-butyl N-[[4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexyl]methyl]carbamate
InChIKeyNCTLNAWWXKBSSW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1CCC(CC1)CNS(=O)(=O)C2=CC3=CC=CC=C3C=C2

Computed by PubChem (NCBI)