Products 1923335-26-5
CAS 1923335-26-5 is the registry number for 3-oxo-5-(trifluoromethyl)cyclohexane-1-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-oxo-5-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 1923335-26-5) is a chemical compound with the molecular formula C8H9F3O3 and a molecular weight of 210.15 g/mol. IUPAC name: 3-oxo-5-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: SEXJGZPRVAVSIY-UHFFFAOYSA-N.
| Molecular formula | C8H9F3O3 |
|---|---|
| Molecular weight | 210.15 g/mol |
| IUPAC name | 3-oxo-5-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | SEXJGZPRVAVSIY-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)