CAS 1923773-01-6 appears in our catalog under these names: MW–150 hydrochloride, MW-150 hydrochloride. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, Get quote.
6-(4-methylpiperazin-1-yl)-3-naphthalen-2-yl-4-pyridin-4-ylpyridazine;hydrochloride (CAS 1923773-01-6) is a chemical compound with the molecular formula C24H24ClN5 and a molecular weight of 417.9 g/mol. IUPAC name: 6-(4-methylpiperazin-1-yl)-3-naphthalen-2-yl-4-pyridin-4-ylpyridazine;hydrochloride. InChIKey: FQMOEAOQYORXPF-UHFFFAOYSA-N.
| Molecular formula | C24H24ClN5 |
|---|---|
| Molecular weight | 417.9 g/mol |
| IUPAC name | 6-(4-methylpiperazin-1-yl)-3-naphthalen-2-yl-4-pyridin-4-ylpyridazine;hydrochloride |
| InChIKey | FQMOEAOQYORXPF-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NN=C(C(=C2)C3=CC=NC=C3)C4=CC5=CC=CC=C5C=C4.Cl |
Computed by PubChem (NCBI)