CAS 1923836-34-3 appears in our catalog under these names: (R)-2-[Cis-4-(6-fluoro-4-quinolyl)cyclohexyl]propanoic acid, 95%, (R)-2-(cis-4-(6-fluoro-4-quinolyl)cyclohexyl)propanoic acid, 95%, (R)-2-[cis-4-(6-Fluoro-4-quinolyl)cyclohexyl]propanoic acid 95%, (R)-2-[cis-4-(6-Fluoro-4-quinolyl)cyclohexyl]propanoic Acid, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 10mg, 25mg, 50mg.
(2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanoic acid (CAS 1923836-34-3) is a chemical compound with the molecular formula C18H20FNO2 and a molecular weight of 301.4 g/mol. IUPAC name: (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanoic acid. InChIKey: XDZXXZVCXUTECU-PNESKVBLSA-N.
| Molecular formula | C18H20FNO2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanoic acid |
| InChIKey | XDZXXZVCXUTECU-PNESKVBLSA-N |
| SMILES | C[C@H](C1CCC(CC1)C2=C3C=C(C=CC3=NC=C2)F)C(=O)O |
Computed by PubChem (NCBI)