CAS 192432-85-2 appears in our catalog under these names: 1-(4-(PYREN-1-YL)BUTANOYL)PYRROLIDINE-2,5-DIONE, 98%, 98%, 1-[1-Oxo-4-(1-pyrenyl)butyl]-2,5-pyrrolidinedione, 98%, 1-(4-(Pyren-1-yl)butanoyl)pyrrolidine-2,5-dione, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(4-pyren-1-ylbutanoyl)pyrrolidine-2,5-dione (CAS 192432-85-2) is a chemical compound with the molecular formula C24H19NO3 and a molecular weight of 369.4 g/mol. IUPAC name: 1-(4-pyren-1-ylbutanoyl)pyrrolidine-2,5-dione. InChIKey: XYJNTRZBYNRQEP-UHFFFAOYSA-N.
| Molecular formula | C24H19NO3 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 1-(4-pyren-1-ylbutanoyl)pyrrolidine-2,5-dione |
| InChIKey | XYJNTRZBYNRQEP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2 |
Computed by PubChem (NCBI)