CAS 192439-46-6 appears in our catalog under these names: Thiamethoxam Impurity 3, Deschloro-2-phenylthio-thiamethoxam, >95% (HPLC), Deschloro-2-phenylthio-thiamethoxam. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[3-methyl-5-[(2-phenylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide (CAS 192439-46-6) is a chemical compound with the molecular formula C14H15N5O3S2 and a molecular weight of 365.4 g/mol. IUPAC name: N-[3-methyl-5-[(2-phenylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide. InChIKey: DPRKJAQMHKISEQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O3S2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | N-[3-methyl-5-[(2-phenylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
| InChIKey | DPRKJAQMHKISEQ-UHFFFAOYSA-N |
| SMILES | CN1COCN(C1=N[N+](=O)[O-])CC2=CN=C(S2)SC3=CC=CC=C3 |
Computed by PubChem (NCBI)