CAS 192448-07-0 appears in our catalog under these names: Posaconazole Impurity 116, (S)–4–(2,4–fluorophenyl)–2–(hydroxy methyl)pent–4–en–1–yl isobutyrate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 1g, 250mg.
[(2S)-4-(2,4-difluorophenyl)-2-(hydroxymethyl)pent-4-enyl] 2-methylpropanoate (CAS 192448-07-0) is a chemical compound with the molecular formula C16H20F2O3 and a molecular weight of 298.32 g/mol. IUPAC name: [(2S)-4-(2,4-difluorophenyl)-2-(hydroxymethyl)pent-4-enyl] 2-methylpropanoate. InChIKey: JACXDHBRMMEIGY-LBPRGKRZSA-N.
| Molecular formula | C16H20F2O3 |
|---|---|
| Molecular weight | 298.32 g/mol |
| IUPAC name | [(2S)-4-(2,4-difluorophenyl)-2-(hydroxymethyl)pent-4-enyl] 2-methylpropanoate |
| InChIKey | JACXDHBRMMEIGY-LBPRGKRZSA-N |
| SMILES | CC(C)C(=O)OC[C@@H](CC(=C)C1=C(C=C(C=C1)F)F)CO |
Computed by PubChem (NCBI)