CAS 19249-97-9 is the registry number for 2-{[(benzoylamino)carbothioyl]amino}-1,1'-biphenyl, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[(2-phenylphenyl)carbamothioyl]benzamide (CAS 19249-97-9) is a chemical compound with the molecular formula C20H16N2OS and a molecular weight of 332.4 g/mol. IUPAC name: N-[(2-phenylphenyl)carbamothioyl]benzamide. InChIKey: VPCKNCJBXDGMQV-UHFFFAOYSA-N.
| Molecular formula | C20H16N2OS |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | N-[(2-phenylphenyl)carbamothioyl]benzamide |
| InChIKey | VPCKNCJBXDGMQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC(=S)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)