CAS 192564-13-9 appears in our catalog under these names: Leteprinim Potassium Salt, Leteprinim potassium, Leteprinim (potassium salt), Leteprinim (potassium), 99.0%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 1mg, 5 mg.
Potassium 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoate (CAS 192564-13-9) is a chemical compound with the molecular formula C15H12KN5O4 and a molecular weight of 365.38 g/mol. IUPAC name: potassium 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoate. InChIKey: MICLTPPSCUXHJT-UHFFFAOYSA-M.
| Molecular formula | C15H12KN5O4 |
|---|---|
| Molecular weight | 365.38 g/mol |
| IUPAC name | potassium 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoate |
| InChIKey | MICLTPPSCUXHJT-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)[O-])NC(=O)CCN2C=NC3=C2N=CNC3=O.[K+] |
Computed by PubChem (NCBI)