Products 1926162-99-3

CAS 1926162-99-3 is the registry number for H-D-Asp(OtBu)-allyl ester·HCl. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg.

Structural formula: {0} (CAS {1})

4-O-tert-butyl 1-O-prop-2-enyl 2-aminobutanedioate;hydrochloride (CAS 1926162-99-3) is a chemical compound with the molecular formula C11H20ClNO4 and a molecular weight of 265.73 g/mol. IUPAC name: 4-O-tert-butyl 1-O-prop-2-enyl 2-aminobutanedioate;hydrochloride. InChIKey: NJRAKVZUBAZRJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO4
Molecular weight265.73 g/mol
IUPAC name4-O-tert-butyl 1-O-prop-2-enyl 2-aminobutanedioate;hydrochloride
InChIKeyNJRAKVZUBAZRJQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC(C(=O)OCC=C)N.Cl

Computed by PubChem (NCBI)