CAS 192696-43-8 appears in our catalog under these names: 3,5-Dimethoxy-2-nitroaniline, 98%, 3,5-Dimethoxy-2-nitroaniline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
3,5-dimethoxy-2-nitroaniline (CAS 192696-43-8) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: 3,5-dimethoxy-2-nitroaniline. InChIKey: GWHSFLQGVWEJAY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 3,5-dimethoxy-2-nitroaniline |
| InChIKey | GWHSFLQGVWEJAY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)[N+](=O)[O-])N |
Computed by PubChem (NCBI)