CAS 1926986-25-5 is the registry number for TAF1 ligand 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-but-3-enyl-4-[6-(morpholine-4-carbonyl)-1H-benzimidazol-4-yl]-1H-pyrrolo[2,3-c]pyridin-7-one (CAS 1926986-25-5) is a chemical compound with the molecular formula C23H23N5O3 and a molecular weight of 417.5 g/mol. IUPAC name: 6-but-3-enyl-4-[6-(morpholine-4-carbonyl)-1H-benzimidazol-4-yl]-1H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: RLNJZBANHSVNDS-UHFFFAOYSA-N.
| Molecular formula | C23H23N5O3 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 6-but-3-enyl-4-[6-(morpholine-4-carbonyl)-1H-benzimidazol-4-yl]-1H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | RLNJZBANHSVNDS-UHFFFAOYSA-N |
| SMILES | C=CCCN1C=C(C2=C(C1=O)NC=C2)C3=C4C(=CC(=C3)C(=O)N5CCOCC5)NC=N4 |
Computed by PubChem (NCBI)