CAS 1927864-38-7 is the registry number for rac-tert-Butyl (1R,5S,6R)-6-(methylamino)-3-azabicyclo(3.1.0)hexane-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (1S,5R)-6-(methylamino)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1927864-38-7) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,5R)-6-(methylamino)-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: SSLHAXMFLXPQSV-JVHMLUBASA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,5R)-6-(methylamino)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | SSLHAXMFLXPQSV-JVHMLUBASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2NC |
Computed by PubChem (NCBI)