CAS 1928707-56-5 appears in our catalog under these names: Olorofim, Olorofim/ 99.28% (existing batch purity), Olorofim, 95%, 95%, Olorofim, 99.38%. Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 250mg, 1g.
2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxoacetamide (CAS 1928707-56-5) is a chemical compound with the molecular formula C28H27FN6O2 and a molecular weight of 498.6 g/mol. IUPAC name: 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxoacetamide. InChIKey: SUFPWYYDCOKDLL-UHFFFAOYSA-N.
| Molecular formula | C28H27FN6O2 |
|---|---|
| Molecular weight | 498.6 g/mol |
| IUPAC name | 2-(1,5-dimethyl-3-phenylpyrrol-2-yl)-N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| InChIKey | SUFPWYYDCOKDLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C)C(=O)C(=O)NC2=CC=C(C=C2)N3CCN(CC3)C4=NC=C(C=N4)F)C5=CC=CC=C5 |
Computed by PubChem (NCBI)