CAS 1929606-72-3 appears in our catalog under these names: 5-Iodo-2-(trifluoromethyl)-1,3-benzoxazole, 95%, 5-Iodo-2-(trifluoromethyl)-1,3-benzoxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-iodo-2-(trifluoromethyl)-1,3-benzoxazole (CAS 1929606-72-3) is a chemical compound with the molecular formula C8H3F3INO and a molecular weight of 313.01 g/mol. IUPAC name: 5-iodo-2-(trifluoromethyl)-1,3-benzoxazole. InChIKey: YQZXSEZVZPCWAC-UHFFFAOYSA-N.
| Molecular formula | C8H3F3INO |
|---|---|
| Molecular weight | 313.01 g/mol |
| IUPAC name | 5-iodo-2-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | YQZXSEZVZPCWAC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)N=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)