CAS 193012-35-0 appears in our catalog under these names: FK 614, FK614, 3-((2,4-Dichlorophenyl)methyl)-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide, FK614, ≥99%, ≥99%, FK614, 99.97%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 10mg, 5mg, 100mg, 50mg, 1mg, 25mg, 50 mg.
3-[(2,4-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide (CAS 193012-35-0) is a chemical compound with the molecular formula C21H23Cl2N3O3S and a molecular weight of 468.4 g/mol. IUPAC name: 3-[(2,4-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide. InChIKey: UYGZODVVDUIDDQ-UHFFFAOYSA-N.
| Molecular formula | C21H23Cl2N3O3S |
|---|---|
| Molecular weight | 468.4 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide |
| InChIKey | UYGZODVVDUIDDQ-UHFFFAOYSA-N |
| SMILES | CCCCCS(=O)(=O)NC(=O)C1=CC2=C(C=C1)N=C(N2CC3=C(C=C(C=C3)Cl)Cl)C |
Computed by PubChem (NCBI)