CAS 19319-86-9 is the registry number for Dibromo(1,10-phenanthroline)copper(II), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibromocopper;1,10-phenanthroline (CAS 19319-86-9) is a chemical compound with the molecular formula C12H8Br2CuN2 and a molecular weight of 403.56 g/mol. IUPAC name: dibromocopper;1,10-phenanthroline. InChIKey: CJUHWXSXGSVTMY-UHFFFAOYSA-L.
| Molecular formula | C12H8Br2CuN2 |
|---|---|
| Molecular weight | 403.56 g/mol |
| IUPAC name | dibromocopper;1,10-phenanthroline |
| InChIKey | CJUHWXSXGSVTMY-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[Cu](Br)Br |
Computed by PubChem (NCBI)