CAS 1931949-99-3 is the registry number for N'-(1-(2,5-Difluorophenyl)ethylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide (CAS 1931949-99-3) is a chemical compound with the molecular formula C15H14F2N2O2S and a molecular weight of 324.3 g/mol. IUPAC name: N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide. InChIKey: YRIQMZVWWZVEQS-WOJGMQOQSA-N.
| Molecular formula | C15H14F2N2O2S |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | YRIQMZVWWZVEQS-WOJGMQOQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(\C)/C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)