CAS 1931993-56-4 is the registry number for tert-Butyl (R)-(3,3,3-trifluoro-2-hydroxypropyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamate (CAS 1931993-56-4) is a chemical compound with the molecular formula C8H14F3NO3 and a molecular weight of 229.20 g/mol. IUPAC name: tert-butyl N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamate. InChIKey: NCSJLZBMIHPPLI-RXMQYKEDSA-N.
| Molecular formula | C8H14F3NO3 |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | tert-butyl N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]carbamate |
| InChIKey | NCSJLZBMIHPPLI-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)