Products 1932013-91-6
CAS 1932013-91-6 is the registry number for (S)-1-(4-Fluoro-3-nitrophenyl)ethan-1-ol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(4-fluoro-3-nitrophenyl)ethanol (CAS 1932013-91-6) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: (1S)-1-(4-fluoro-3-nitrophenyl)ethanol. InChIKey: IACYNVDAYQTIKW-YFKPBYRVSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | (1S)-1-(4-fluoro-3-nitrophenyl)ethanol |
| InChIKey | IACYNVDAYQTIKW-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)